About 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide
4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide (PubChem CID 82494160) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide |
| PubChem CID | 82494160 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1/C(N)=N/O |
| InChI | InChI=1S/C13H20N2O/c1-8-6-10(13(3,4)5)7-9(2)11(8)12(14)15-16/h6-7,16H,1-5H3,(H2,14,15) |
| InChIKey | WKCWQIODALMEPV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide?
The IUPAC name of 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide (CID 82494160) is 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide.
What is the SMILES notation for 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide?
The canonical SMILES for 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide is Cc1cc(C(C)(C)C)cc(C)c1/C(N)=N/O.
What is the InChIKey of 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide?
The InChIKey is WKCWQIODALMEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-8-6-10(13(3,4)5)7-9(2)11(8)12(14)15-16/h6-7,16H,1-5H3,(H2,14,15).
What are the key properties of 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide?
4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide has a molecular weight of 220.32 g/mol, XLogP of 2.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N'-hydroxy-2,6-dimethylbenzenecarboximidamide is sourced from PubChem (CID 82494160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).