C13H19NO2 — CID 82494307
2-[(2,3,5,6-tetramethylphenyl)methylamino]acetic acid (PubChem CID 82494307) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(2,3,5,6-tetramethylphenyl)methylamino]acetic acid.
| Compound Name | 2-[(2,3,5,6-tetramethylphenyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 82494307 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[(2,3,5,6-tetramethylphenyl)methylamino]acetic acid |
| SMILES | Cc1cc(C)c(C)c(CNCC(=O)O)c1C |
| InChI | InChI=1S/C13H19NO2/c1-8-5-9(2)11(4)12(10(8)3)6-14-7-13(15)16/h5,14H,6-7H2,1-4H3,(H,15,16) |
| InChIKey | LEJPOJRLOPUBEW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |