C16H22N2 — CID 82497336
3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine (PubChem CID 82497336) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine.
| Compound Name | 3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine |
|---|---|
| PubChem CID | 82497336 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine |
| SMILES | Cc1ccc2c3c(n(CCCN)c2c1)CCCC3 |
| InChI | InChI=1S/C16H22N2/c1-12-7-8-14-13-5-2-3-6-15(13)18(10-4-9-17)16(14)11-12/h7-8,11H,2-6,9-10,17H2,1H3 |
| InChIKey | CDQLATBAKAOHMI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|