C15H17NO2 — CID 82497374
(E)-3-(5-ethyl-1,2-dimethylindol-3-yl)prop-2-enoic acid (PubChem CID 82497374) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (E)-3-(5-ethyl-1,2-dimethylindol-3-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(5-ethyl-1,2-dimethylindol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82497374 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (E)-3-(5-ethyl-1,2-dimethylindol-3-yl)prop-2-enoic acid |
| SMILES | CCc1ccc2c(c1)c(/C=C/C(=O)O)c(C)n2C |
| InChI | InChI=1S/C15H17NO2/c1-4-11-5-7-14-13(9-11)12(6-8-15(17)18)10(2)16(14)3/h5-9H,4H2,1-3H3,(H,17,18)/b8-6+ |
| InChIKey | HKKXOVIQQCBACI-SOFGYWHQSA-N |
| XLogP | 3.15 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|