About N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine
N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine (PubChem CID 82497754) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine |
| PubChem CID | 82497754 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine |
| SMILES | Cc1cc(C)c2c(CCNC(C)(C)C)c[nH]c2c1 |
| InChI | InChI=1S/C16H24N2/c1-11-8-12(2)15-13(10-17-14(15)9-11)6-7-18-16(3,4)5/h8-10,17-18H,6-7H2,1-5H3 |
| InChIKey | KWDUUMYWCXLPEK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine?
The IUPAC name of N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine (CID 82497754) is N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine is Cc1cc(C)c2c(CCNC(C)(C)C)c[nH]c2c1.
What is the InChIKey of N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine?
The InChIKey is KWDUUMYWCXLPEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-11-8-12(2)15-13(10-17-14(15)9-11)6-7-18-16(3,4)5/h8-10,17-18H,6-7H2,1-5H3.
What are the key properties of N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine?
N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine has a molecular weight of 244.38 g/mol, XLogP of 3.72, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,6-dimethyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine is sourced from PubChem (CID 82497754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).