C14H18N2O2 — CID 82498212
6,8-dimethoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 82498212) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6,8-dimethoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 6,8-dimethoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 82498212 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6,8-dimethoxy-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | COc1cc(OC)c2c(c1)c1c(n2C)CCNC1 |
| InChI | InChI=1S/C14H18N2O2/c1-16-12-4-5-15-8-11(12)10-6-9(17-2)7-13(18-3)14(10)16/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | WXVXCKIEMNDAEK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|