C15H20N2O2 — CID 82500584
[1-(5,7-dimethoxy-1-methylindol-3-yl)cyclopropyl]methanamine (PubChem CID 82500584) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [1-(5,7-dimethoxy-1-methylindol-3-yl)cyclopropyl]methanamine.
| Compound Name | [1-(5,7-dimethoxy-1-methylindol-3-yl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 82500584 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [1-(5,7-dimethoxy-1-methylindol-3-yl)cyclopropyl]methanamine |
| SMILES | COc1cc(OC)c2c(c1)c(C1(CN)CC1)cn2C |
| InChI | InChI=1S/C15H20N2O2/c1-17-8-12(15(9-16)4-5-15)11-6-10(18-2)7-13(19-3)14(11)17/h6-8H,4-5,9,16H2,1-3H3 |
| InChIKey | XFQNMRRGVLYHSI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |