C15H20N2S — CID 82500700
N-[2-(2-methyl-1,3-benzothiazol-5-yl)ethyl]cyclopentanamine (PubChem CID 82500700) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-benzothiazol-5-yl)ethyl]cyclopentanamine.
| Compound Name | N-[2-(2-methyl-1,3-benzothiazol-5-yl)ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 82500700 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-[2-(2-methyl-1,3-benzothiazol-5-yl)ethyl]cyclopentanamine |
| SMILES | Cc1nc2cc(CCNC3CCCC3)ccc2s1 |
| InChI | InChI=1S/C15H20N2S/c1-11-17-14-10-12(6-7-15(14)18-11)8-9-16-13-4-2-3-5-13/h6-7,10,13,16H,2-5,8-9H2,1H3 |
| InChIKey | JFEUORLVQCMZLZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |