C14H18N2O3 — CID 82501036
3-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methylamino]propanoic acid (PubChem CID 82501036) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methylamino]propanoic acid.
| Compound Name | 3-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 82501036 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)methylamino]propanoic acid |
| SMILES | CN1C(=O)CCc2cc(CNCCC(=O)O)ccc21 |
| InChI | InChI=1S/C14H18N2O3/c1-16-12-4-2-10(9-15-7-6-14(18)19)8-11(12)3-5-13(16)17/h2,4,8,15H,3,5-7,9H2,1H3,(H,18,19) |
| InChIKey | WOGWQNLEOGCWRV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|