About 1-(2-aminoethyl)-1,2,4-triazol-3-amine
1-(2-aminoethyl)-1,2,4-triazol-3-amine (PubChem CID 82502401) has the molecular formula C4H9N5
and a molecular weight of 127.15 g/mol. Its IUPAC name is 1-(2-aminoethyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-(2-aminoethyl)-1,2,4-triazol-3-amine |
| PubChem CID | 82502401 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | 1-(2-aminoethyl)-1,2,4-triazol-3-amine |
| SMILES | NCCn1cnc(N)n1 |
| InChI | InChI=1S/C4H9N5/c5-1-2-9-3-7-4(6)8-9/h3H,1-2,5H2,(H2,6,8) |
| InChIKey | GLJKUHIPWXXVHW-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-aminoethyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoethyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-(2-aminoethyl)-1,2,4-triazol-3-amine (CID 82502401) is 1-(2-aminoethyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-(2-aminoethyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-(2-aminoethyl)-1,2,4-triazol-3-amine is NCCn1cnc(N)n1.
What is the InChIKey of 1-(2-aminoethyl)-1,2,4-triazol-3-amine?
The InChIKey is GLJKUHIPWXXVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5/c5-1-2-9-3-7-4(6)8-9/h3H,1-2,5H2,(H2,6,8).
What are the key properties of 1-(2-aminoethyl)-1,2,4-triazol-3-amine?
1-(2-aminoethyl)-1,2,4-triazol-3-amine has a molecular weight of 127.15 g/mol, XLogP of -1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoethyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 82502401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).