About 4-(2-aminoethyl)-1,4-thiazin-3-one
4-(2-aminoethyl)-1,4-thiazin-3-one (PubChem CID 82502740) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,4-thiazin-3-one.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-1,4-thiazin-3-one |
| PubChem CID | 82502740 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 4-(2-aminoethyl)-1,4-thiazin-3-one |
| SMILES | NCCN1C=CSCC1=O |
| InChI | InChI=1S/C6H10N2OS/c7-1-2-8-3-4-10-5-6(8)9/h3-4H,1-2,5,7H2 |
| InChIKey | PNUZHRBGAIIAML-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoethyl)-1,4-thiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-1,4-thiazin-3-one?
The IUPAC name of 4-(2-aminoethyl)-1,4-thiazin-3-one (CID 82502740) is 4-(2-aminoethyl)-1,4-thiazin-3-one.
What is the SMILES notation for 4-(2-aminoethyl)-1,4-thiazin-3-one?
The canonical SMILES for 4-(2-aminoethyl)-1,4-thiazin-3-one is NCCN1C=CSCC1=O.
What is the InChIKey of 4-(2-aminoethyl)-1,4-thiazin-3-one?
The InChIKey is PNUZHRBGAIIAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c7-1-2-8-3-4-10-5-6(8)9/h3-4H,1-2,5,7H2.
What are the key properties of 4-(2-aminoethyl)-1,4-thiazin-3-one?
4-(2-aminoethyl)-1,4-thiazin-3-one has a molecular weight of 158.23 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-1,4-thiazin-3-one is sourced from PubChem (CID 82502740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).