About (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine
(3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine (PubChem CID 82503896) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine |
| PubChem CID | 82503896 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine |
| SMILES | Cc1[nH]nc2sc(CN)c(C)c12 |
| InChI | InChI=1S/C8H11N3S/c1-4-6(3-9)12-8-7(4)5(2)10-11-8/h3,9H2,1-2H3,(H,10,11) |
| InChIKey | IWZKVILCOFKTRY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine?
The IUPAC name of (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine (CID 82503896) is (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine.
What is the SMILES notation for (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine?
The canonical SMILES for (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine is Cc1[nH]nc2sc(CN)c(C)c12.
What is the InChIKey of (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine?
The InChIKey is IWZKVILCOFKTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-4-6(3-9)12-8-7(4)5(2)10-11-8/h3,9H2,1-2H3,(H,10,11).
What are the key properties of (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine?
(3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine has a molecular weight of 181.26 g/mol, XLogP of 1.70, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethyl-2H-thieno[2,3-c]pyrazol-5-yl)methanamine is sourced from PubChem (CID 82503896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).