About (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine
(2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine (PubChem CID 82504497) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine.
Molecular Properties
| Compound Name | (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine |
| PubChem CID | 82504497 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine |
| SMILES | C=CCN1Cc2ccc(CN)cc2C1 |
| InChI | InChI=1S/C12H16N2/c1-2-5-14-8-11-4-3-10(7-13)6-12(11)9-14/h2-4,6H,1,5,7-9,13H2 |
| InChIKey | FNCNMXIEXDVHSX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine?
The IUPAC name of (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine (CID 82504497) is (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine.
What is the SMILES notation for (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine?
The canonical SMILES for (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine is C=CCN1Cc2ccc(CN)cc2C1.
What is the InChIKey of (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine?
The InChIKey is FNCNMXIEXDVHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-2-5-14-8-11-4-3-10(7-13)6-12(11)9-14/h2-4,6H,1,5,7-9,13H2.
What are the key properties of (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine?
(2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine has a molecular weight of 188.27 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-prop-2-enyl-1,3-dihydroisoindol-5-yl)methanamine is sourced from PubChem (CID 82504497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).