About 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one
4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one (PubChem CID 82506166) has the molecular formula C9H16N2OS
and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one.
Molecular Properties
| Compound Name | 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one |
| PubChem CID | 82506166 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one |
| SMILES | CC1=C(C)N(C(C)CN)C(=O)CS1 |
| InChI | InChI=1S/C9H16N2OS/c1-6(4-10)11-7(2)8(3)13-5-9(11)12/h6H,4-5,10H2,1-3H3 |
| InChIKey | WAZWFQVSKLBWLK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one?
The IUPAC name of 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one (CID 82506166) is 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one.
What is the SMILES notation for 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one?
The canonical SMILES for 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one is CC1=C(C)N(C(C)CN)C(=O)CS1.
What is the InChIKey of 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one?
The InChIKey is WAZWFQVSKLBWLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS/c1-6(4-10)11-7(2)8(3)13-5-9(11)12/h6H,4-5,10H2,1-3H3.
What are the key properties of 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one?
4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one has a molecular weight of 200.31 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminopropan-2-yl)-5,6-dimethyl-1,4-thiazin-3-one is sourced from PubChem (CID 82506166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).