About N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide
N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide (PubChem CID 82506226) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide |
| PubChem CID | 82506226 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide |
| SMILES | CC1(C)COCCN1C(=O)NCCN |
| InChI | InChI=1S/C9H19N3O2/c1-9(2)7-14-6-5-12(9)8(13)11-4-3-10/h3-7,10H2,1-2H3,(H,11,13) |
| InChIKey | ISGYOQQDYMSTDG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide?
The IUPAC name of N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide (CID 82506226) is N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide is CC1(C)COCCN1C(=O)NCCN.
What is the InChIKey of N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide?
The InChIKey is ISGYOQQDYMSTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2/c1-9(2)7-14-6-5-12(9)8(13)11-4-3-10/h3-7,10H2,1-2H3,(H,11,13).
What are the key properties of N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide?
N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide has a molecular weight of 201.27 g/mol, XLogP of -0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-3,3-dimethylmorpholine-4-carboxamide is sourced from PubChem (CID 82506226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).