About 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one
6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one (PubChem CID 82506308) has the molecular formula C8H12ClN3O
and a molecular weight of 201.66 g/mol. Its IUPAC name is 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one |
| PubChem CID | 82506308 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one |
| SMILES | C=C(Cl)CN1N=C(CN)CCC1=O |
| InChI | InChI=1S/C8H12ClN3O/c1-6(9)5-12-8(13)3-2-7(4-10)11-12/h1-5,10H2 |
| InChIKey | DDIQBHLQLALQBQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one?
The IUPAC name of 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one (CID 82506308) is 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one?
The canonical SMILES for 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one is C=C(Cl)CN1N=C(CN)CCC1=O.
What is the InChIKey of 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one?
The InChIKey is DDIQBHLQLALQBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN3O/c1-6(9)5-12-8(13)3-2-7(4-10)11-12/h1-5,10H2.
What are the key properties of 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one?
6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one has a molecular weight of 201.66 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-2-(2-chloroprop-2-enyl)-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 82506308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).