About 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one
5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one (PubChem CID 82507025) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one |
| PubChem CID | 82507025 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one |
| SMILES | NCc1ccc(=O)n(Cc2ncon2)c1 |
| InChI | InChI=1S/C9H10N4O2/c10-3-7-1-2-9(14)13(4-7)5-8-11-6-15-12-8/h1-2,4,6H,3,5,10H2 |
| InChIKey | IXBZMWDWDVKYKX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
The IUPAC name of 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one (CID 82507025) is 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one.
What is the SMILES notation for 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
The canonical SMILES for 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one is NCc1ccc(=O)n(Cc2ncon2)c1.
What is the InChIKey of 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
The InChIKey is IXBZMWDWDVKYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c10-3-7-1-2-9(14)13(4-7)5-8-11-6-15-12-8/h1-2,4,6H,3,5,10H2.
What are the key properties of 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one has a molecular weight of 206.21 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one is sourced from PubChem (CID 82507025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).