About 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one
3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one (PubChem CID 82507029) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one |
| PubChem CID | 82507029 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one |
| SMILES | NCc1cccn(Cc2ncon2)c1=O |
| InChI | InChI=1S/C9H10N4O2/c10-4-7-2-1-3-13(9(7)14)5-8-11-6-15-12-8/h1-3,6H,4-5,10H2 |
| InChIKey | WRAUEEMLZVWEMN-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
The IUPAC name of 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one (CID 82507029) is 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one.
What is the SMILES notation for 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
The canonical SMILES for 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one is NCc1cccn(Cc2ncon2)c1=O.
What is the InChIKey of 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
The InChIKey is WRAUEEMLZVWEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c10-4-7-2-1-3-13(9(7)14)5-8-11-6-15-12-8/h1-3,6H,4-5,10H2.
What are the key properties of 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one?
3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one has a molecular weight of 206.21 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-1-(1,2,4-oxadiazol-3-ylmethyl)pyridin-2-one is sourced from PubChem (CID 82507029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).