C11H10F2N2 — CID 82507508
(6,8-difluoro-2-methylquinolin-4-yl)methanamine (PubChem CID 82507508) has the molecular formula C11H10F2N2 and a molecular weight of 208.21 g/mol. Its IUPAC name is (6,8-difluoro-2-methylquinolin-4-yl)methanamine.
| Compound Name | (6,8-difluoro-2-methylquinolin-4-yl)methanamine |
|---|---|
| PubChem CID | 82507508 |
| Molecular Formula | C11H10F2N2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (6,8-difluoro-2-methylquinolin-4-yl)methanamine |
| SMILES | Cc1cc(CN)c2cc(F)cc(F)c2n1 |
| InChI | InChI=1S/C11H10F2N2/c1-6-2-7(5-14)9-3-8(12)4-10(13)11(9)15-6/h2-4H,5,14H2,1H3 |
| InChIKey | VZTDBRXZAMWBJU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |