C9H8ClN3O — CID 82507970
3-(aminomethyl)-7-chloropyrido[1,2-a]pyrimidin-4-one (PubChem CID 82507970) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 3-(aminomethyl)-7-chloropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(aminomethyl)-7-chloropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 82507970 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3-(aminomethyl)-7-chloropyrido[1,2-a]pyrimidin-4-one |
| SMILES | NCc1cnc2ccc(Cl)cn2c1=O |
| InChI | InChI=1S/C9H8ClN3O/c10-7-1-2-8-12-4-6(3-11)9(14)13(8)5-7/h1-2,4-5H,3,11H2 |
| InChIKey | NZNCXDJUJPZIFL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |