About 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione
3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione (PubChem CID 82508004) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione |
| PubChem CID | 82508004 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione |
| SMILES | NCc1cc(CN2C(=O)CNC2=O)on1 |
| InChI | InChI=1S/C8H10N4O3/c9-2-5-1-6(15-11-5)4-12-7(13)3-10-8(12)14/h1H,2-4,9H2,(H,10,14) |
| InChIKey | LIZGKFLDOICPFU-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione?
The IUPAC name of 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione (CID 82508004) is 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione.
What is the SMILES notation for 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione?
The canonical SMILES for 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione is NCc1cc(CN2C(=O)CNC2=O)on1.
What is the InChIKey of 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione?
The InChIKey is LIZGKFLDOICPFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3/c9-2-5-1-6(15-11-5)4-12-7(13)3-10-8(12)14/h1H,2-4,9H2,(H,10,14).
What are the key properties of 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione?
3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione has a molecular weight of 210.19 g/mol, XLogP of -0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(aminomethyl)-1,2-oxazol-5-yl]methyl]imidazolidine-2,4-dione is sourced from PubChem (CID 82508004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).