About (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine
(5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine (PubChem CID 82508197) has the molecular formula C11H18N2S
and a molecular weight of 210.35 g/mol. Its IUPAC name is (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine.
Molecular Properties
| Compound Name | (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine |
| PubChem CID | 82508197 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine |
| SMILES | CC(C)N1CCc2sc(CN)cc2C1 |
| InChI | InChI=1S/C11H18N2S/c1-8(2)13-4-3-11-9(7-13)5-10(6-12)14-11/h5,8H,3-4,6-7,12H2,1-2H3 |
| InChIKey | DLHCKZNIRQZRRZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine?
The IUPAC name of (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine (CID 82508197) is (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine.
What is the SMILES notation for (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine?
The canonical SMILES for (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine is CC(C)N1CCc2sc(CN)cc2C1.
What is the InChIKey of (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine?
The InChIKey is DLHCKZNIRQZRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2S/c1-8(2)13-4-3-11-9(7-13)5-10(6-12)14-11/h5,8H,3-4,6-7,12H2,1-2H3.
What are the key properties of (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine?
(5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine has a molecular weight of 210.35 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propan-2-yl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)methanamine is sourced from PubChem (CID 82508197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).