About 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone
1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 82508326) has the molecular formula C9H13N3OS
and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone |
| PubChem CID | 82508326 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)N1CCNCC1 |
| InChI | InChI=1S/C9H13N3OS/c13-9(5-8-6-11-7-14-8)12-3-1-10-2-4-12/h6-7,10H,1-5H2 |
| InChIKey | WGGMSYNTXGOJMJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone (CID 82508326) is 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone is O=C(Cc1cncs1)N1CCNCC1.
What is the InChIKey of 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone?
The InChIKey is WGGMSYNTXGOJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS/c13-9(5-8-6-11-7-14-8)12-3-1-10-2-4-12/h6-7,10H,1-5H2.
What are the key properties of 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone?
1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone has a molecular weight of 211.29 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-yl-2-(1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 82508326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).