About 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine
3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine (PubChem CID 82508707) has the molecular formula C8H15N5S
and a molecular weight of 213.31 g/mol. Its IUPAC name is 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine |
| PubChem CID | 82508707 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine |
| SMILES | NCC1(Sc2nncn2N)CCCC1 |
| InChI | InChI=1S/C8H15N5S/c9-5-8(3-1-2-4-8)14-7-12-11-6-13(7)10/h6H,1-5,9-10H2 |
| InChIKey | KEGYYEOVRBXKMH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine?
The IUPAC name of 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine (CID 82508707) is 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine?
The canonical SMILES for 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine is NCC1(Sc2nncn2N)CCCC1.
What is the InChIKey of 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine?
The InChIKey is KEGYYEOVRBXKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5S/c9-5-8(3-1-2-4-8)14-7-12-11-6-13(7)10/h6H,1-5,9-10H2.
What are the key properties of 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine?
3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine has a molecular weight of 213.31 g/mol, XLogP of 0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(aminomethyl)cyclopentyl]sulfanyl-1,2,4-triazol-4-amine is sourced from PubChem (CID 82508707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).