About N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide
N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide (PubChem CID 82508904) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide |
| PubChem CID | 82508904 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)N(C)C(C)CN |
| InChI | InChI=1S/C8H14N4OS/c1-5(4-9)12(3)8(13)7-6(2)10-11-14-7/h5H,4,9H2,1-3H3 |
| InChIKey | IAMXEPHGDPIAFF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide?
The IUPAC name of N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide (CID 82508904) is N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide.
What is the SMILES notation for N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide?
The canonical SMILES for N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide is Cc1nnsc1C(=O)N(C)C(C)CN.
What is the InChIKey of N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide?
The InChIKey is IAMXEPHGDPIAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c1-5(4-9)12(3)8(13)7-6(2)10-11-14-7/h5H,4,9H2,1-3H3.
What are the key properties of N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide?
N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide has a molecular weight of 214.29 g/mol, XLogP of 0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminopropan-2-yl)-N,4-dimethylthiadiazole-5-carboxamide is sourced from PubChem (CID 82508904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).