C13H21N3 — CID 82509242
2,3-dimethyl-5-(piperazin-1-ylmethyl)aniline (PubChem CID 82509242) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2,3-dimethyl-5-(piperazin-1-ylmethyl)aniline.
| Compound Name | 2,3-dimethyl-5-(piperazin-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 82509242 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2,3-dimethyl-5-(piperazin-1-ylmethyl)aniline |
| SMILES | Cc1cc(CN2CCNCC2)cc(N)c1C |
| InChI | InChI=1S/C13H21N3/c1-10-7-12(8-13(14)11(10)2)9-16-5-3-15-4-6-16/h7-8,15H,3-6,9,14H2,1-2H3 |
| InChIKey | PGIJZNBWJUNLIT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|