About 6-(triazol-1-yl)-2,3-dihydro-1H-indole
6-(triazol-1-yl)-2,3-dihydro-1H-indole (PubChem CID 82512188) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 6-(triazol-1-yl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6-(triazol-1-yl)-2,3-dihydro-1H-indole |
| PubChem CID | 82512188 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 6-(triazol-1-yl)-2,3-dihydro-1H-indole |
| SMILES | c1cn(-c2ccc3c(c2)NCC3)nn1 |
| InChI | InChI=1S/C10H10N4/c1-2-9(14-6-5-12-13-14)7-10-8(1)3-4-11-10/h1-2,5-7,11H,3-4H2 |
| InChIKey | LFHYXDSFKHSIGS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(triazol-1-yl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(triazol-1-yl)-2,3-dihydro-1H-indole?
The IUPAC name of 6-(triazol-1-yl)-2,3-dihydro-1H-indole (CID 82512188) is 6-(triazol-1-yl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 6-(triazol-1-yl)-2,3-dihydro-1H-indole?
The canonical SMILES for 6-(triazol-1-yl)-2,3-dihydro-1H-indole is c1cn(-c2ccc3c(c2)NCC3)nn1.
What is the InChIKey of 6-(triazol-1-yl)-2,3-dihydro-1H-indole?
The InChIKey is LFHYXDSFKHSIGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c1-2-9(14-6-5-12-13-14)7-10-8(1)3-4-11-10/h1-2,5-7,11H,3-4H2.
What are the key properties of 6-(triazol-1-yl)-2,3-dihydro-1H-indole?
6-(triazol-1-yl)-2,3-dihydro-1H-indole has a molecular weight of 186.22 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(triazol-1-yl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 82512188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).