C12H9FN4 — CID 82512905
2-fluoro-5-imidazo[4,5-b]pyridin-3-ylaniline (PubChem CID 82512905) has the molecular formula C12H9FN4 and a molecular weight of 228.23 g/mol. Its IUPAC name is 2-fluoro-5-imidazo[4,5-b]pyridin-3-ylaniline.
| Compound Name | 2-fluoro-5-imidazo[4,5-b]pyridin-3-ylaniline |
|---|---|
| PubChem CID | 82512905 |
| Molecular Formula | C12H9FN4 |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-fluoro-5-imidazo[4,5-b]pyridin-3-ylaniline |
| SMILES | Nc1cc(-n2cnc3cccnc32)ccc1F |
| InChI | InChI=1S/C12H9FN4/c13-9-4-3-8(6-10(9)14)17-7-16-11-2-1-5-15-12(11)17/h1-7H,14H2 |
| InChIKey | CTVNIEFMEVDRHP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|