C12H9N3OS2 — CID 82514693
5-[2-(2-methylphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82514693) has the molecular formula C12H9N3OS2 and a molecular weight of 275.36 g/mol. Its IUPAC name is 5-[2-(2-methylphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(2-methylphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82514693 |
| Molecular Formula | C12H9N3OS2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 5-[2-(2-methylphenyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1ccccc1-c1ncc(-c2n[nH]c(=S)o2)s1 |
| InChI | InChI=1S/C12H9N3OS2/c1-7-4-2-3-5-8(7)11-13-6-9(18-11)10-14-15-12(17)16-10/h2-6H,1H3,(H,15,17) |
| InChIKey | QNQCOBCVKAEBEA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|