C18H18N2O2 — CID 82517897
2-[1-cyclopropyl-6-(4-ethoxyphenyl)-2-oxo-3-pyridinyl]acetonitrile (PubChem CID 82517897) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[1-cyclopropyl-6-(4-ethoxyphenyl)-2-oxo-3-pyridinyl]acetonitrile.
| Compound Name | 2-[1-cyclopropyl-6-(4-ethoxyphenyl)-2-oxo-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 82517897 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[1-cyclopropyl-6-(4-ethoxyphenyl)-2-oxo-3-pyridinyl]acetonitrile |
| SMILES | CCOc1ccc(-c2ccc(CC#N)c(=O)n2C2CC2)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-2-22-16-8-3-13(4-9-16)17-10-5-14(11-12-19)18(21)20(17)15-6-7-15/h3-5,8-10,15H,2,6-7,11H2,1H3 |
| InChIKey | XORZYQIVJOFANV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |