C17H21FN2O — CID 82519507
6-(4-fluorophenyl)-3-(methylaminomethyl)-1-(2-methylpropyl)pyridin-2-one (PubChem CID 82519507) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-(methylaminomethyl)-1-(2-methylpropyl)pyridin-2-one.
| Compound Name | 6-(4-fluorophenyl)-3-(methylaminomethyl)-1-(2-methylpropyl)pyridin-2-one |
|---|---|
| PubChem CID | 82519507 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-(4-fluorophenyl)-3-(methylaminomethyl)-1-(2-methylpropyl)pyridin-2-one |
| SMILES | CNCc1ccc(-c2ccc(F)cc2)n(CC(C)C)c1=O |
| InChI | InChI=1S/C17H21FN2O/c1-12(2)11-20-16(13-4-7-15(18)8-5-13)9-6-14(10-19-3)17(20)21/h4-9,12,19H,10-11H2,1-3H3 |
| InChIKey | SYHRTVUTJSDPEX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |