C19H22N2O2 — CID 82519984
2-[6-(3,4-dimethylphenyl)-1-(3-methoxypropyl)-2-oxo-3-pyridinyl]acetonitrile (PubChem CID 82519984) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[6-(3,4-dimethylphenyl)-1-(3-methoxypropyl)-2-oxo-3-pyridinyl]acetonitrile.
| Compound Name | 2-[6-(3,4-dimethylphenyl)-1-(3-methoxypropyl)-2-oxo-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 82519984 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[6-(3,4-dimethylphenyl)-1-(3-methoxypropyl)-2-oxo-3-pyridinyl]acetonitrile |
| SMILES | COCCCn1c(-c2ccc(C)c(C)c2)ccc(CC#N)c1=O |
| InChI | InChI=1S/C19H22N2O2/c1-14-5-6-17(13-15(14)2)18-8-7-16(9-10-20)19(22)21(18)11-4-12-23-3/h5-8,13H,4,9,11-12H2,1-3H3 |
| InChIKey | LZRJINKRLLDCDF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|