C15H14N2O — CID 82520358
2-[6-(2,4-dimethylphenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile (PubChem CID 82520358) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[6-(2,4-dimethylphenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile.
| Compound Name | 2-[6-(2,4-dimethylphenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 82520358 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-[6-(2,4-dimethylphenyl)-2-oxo-1H-pyridin-3-yl]acetonitrile |
| SMILES | Cc1ccc(-c2ccc(CC#N)c(=O)[nH]2)c(C)c1 |
| InChI | InChI=1S/C15H14N2O/c1-10-3-5-13(11(2)9-10)14-6-4-12(7-8-16)15(18)17-14/h3-6,9H,7H2,1-2H3,(H,17,18) |
| InChIKey | CWYXPZVESCVXGW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |