C15H24N2OS — CID 82521858
6-methyl-1-pentyl-3-(sulfanylmethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-one (PubChem CID 82521858) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 6-methyl-1-pentyl-3-(sulfanylmethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-one.
| Compound Name | 6-methyl-1-pentyl-3-(sulfanylmethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 82521858 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 6-methyl-1-pentyl-3-(sulfanylmethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-one |
| SMILES | CCCCCn1c2c(cc(CS)c1=O)CN(C)CC2 |
| InChI | InChI=1S/C15H24N2OS/c1-3-4-5-7-17-14-6-8-16(2)10-12(14)9-13(11-19)15(17)18/h9,19H,3-8,10-11H2,1-2H3 |
| InChIKey | WZZRESDNAJVIGV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 25.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|