C14H22N4O — CID 82521884
1-butan-2-yl-6-methyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carboximidamide (PubChem CID 82521884) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-butan-2-yl-6-methyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carboximidamide.
| Compound Name | 1-butan-2-yl-6-methyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carboximidamide |
|---|---|
| PubChem CID | 82521884 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-butan-2-yl-6-methyl-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(n(C(C)CC)c1=O)CCN(C)C2 |
| InChI | InChI=1S/C14H22N4O/c1-4-9(2)18-12-5-6-17(3)8-10(12)7-11(13(15)16)14(18)19/h7,9H,4-6,8H2,1-3H3,(H3,15,16) |
| InChIKey | PZWZJMCCHXJVBS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|