C14H17N5OS — CID 82521958
1-cyclopropyl-6-methyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one (PubChem CID 82521958) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-cyclopropyl-6-methyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one.
| Compound Name | 1-cyclopropyl-6-methyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 82521958 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-cyclopropyl-6-methyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)-7,8-dihydro-5H-1,6-naphthyridin-2-one |
| SMILES | CN1CCc2c(cc(-c3nc(=S)[nH][nH]3)c(=O)n2C2CC2)C1 |
| InChI | InChI=1S/C14H17N5OS/c1-18-5-4-11-8(7-18)6-10(12-15-14(21)17-16-12)13(20)19(11)9-2-3-9/h6,9H,2-5,7H2,1H3,(H2,15,16,17,21) |
| InChIKey | HMLIHHYUEVIKSA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|