C15H20ClNO3 — CID 82522206
3-[1-(2-methoxyethyl)-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl]propanoyl chloride (PubChem CID 82522206) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 3-[1-(2-methoxyethyl)-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl]propanoyl chloride.
| Compound Name | 3-[1-(2-methoxyethyl)-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl]propanoyl chloride |
|---|---|
| PubChem CID | 82522206 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-[1-(2-methoxyethyl)-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl]propanoyl chloride |
| SMILES | COCCn1c2c(cc(CCC(=O)Cl)c1=O)CCCC2 |
| InChI | InChI=1S/C15H20ClNO3/c1-20-9-8-17-13-5-3-2-4-11(13)10-12(15(17)19)6-7-14(16)18/h10H,2-9H2,1H3 |
| InChIKey | HTUQRSQKNWPTKZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|