C17H24ClNO2 — CID 82522293
3-(2-oxo-1-pentyl-5,6,7,8-tetrahydroquinolin-3-yl)propanoyl chloride (PubChem CID 82522293) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 3-(2-oxo-1-pentyl-5,6,7,8-tetrahydroquinolin-3-yl)propanoyl chloride.
| Compound Name | 3-(2-oxo-1-pentyl-5,6,7,8-tetrahydroquinolin-3-yl)propanoyl chloride |
|---|---|
| PubChem CID | 82522293 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-(2-oxo-1-pentyl-5,6,7,8-tetrahydroquinolin-3-yl)propanoyl chloride |
| SMILES | CCCCCn1c2c(cc(CCC(=O)Cl)c1=O)CCCC2 |
| InChI | InChI=1S/C17H24ClNO2/c1-2-3-6-11-19-15-8-5-4-7-13(15)12-14(17(19)21)9-10-16(18)20/h12H,2-11H2,1H3 |
| InChIKey | TXNNGAHQTFZUGJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|