C15H20ClNO2 — CID 82522325
2-(1-butan-2-yl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride (PubChem CID 82522325) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 2-(1-butan-2-yl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride.
| Compound Name | 2-(1-butan-2-yl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride |
|---|---|
| PubChem CID | 82522325 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(1-butan-2-yl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride |
| SMILES | CCC(C)n1c2c(cc(CC(=O)Cl)c1=O)CCCC2 |
| InChI | InChI=1S/C15H20ClNO2/c1-3-10(2)17-13-7-5-4-6-11(13)8-12(15(17)19)9-14(16)18/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | UIJZKAACFIJCSU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|