C14H18ClNO2 — CID 82522472
2-(2-oxo-1-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride (PubChem CID 82522472) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(2-oxo-1-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride.
| Compound Name | 2-(2-oxo-1-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride |
|---|---|
| PubChem CID | 82522472 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(2-oxo-1-propan-2-yl-5,6,7,8-tetrahydroquinolin-3-yl)acetyl chloride |
| SMILES | CC(C)n1c2c(cc(CC(=O)Cl)c1=O)CCCC2 |
| InChI | InChI=1S/C14H18ClNO2/c1-9(2)16-12-6-4-3-5-10(12)7-11(14(16)18)8-13(15)17/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | UUSRXYHCVRYKDC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|