C19H24N2O — CID 82522528
3-[amino(phenyl)methyl]-1-propyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 82522528) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-[amino(phenyl)methyl]-1-propyl-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 3-[amino(phenyl)methyl]-1-propyl-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 82522528 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3-[amino(phenyl)methyl]-1-propyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CCCn1c2c(cc(C(N)c3ccccc3)c1=O)CCCC2 |
| InChI | InChI=1S/C19H24N2O/c1-2-12-21-17-11-7-6-10-15(17)13-16(19(21)22)18(20)14-8-4-3-5-9-14/h3-5,8-9,13,18H,2,6-7,10-12,20H2,1H3 |
| InChIKey | RXMWGIKVADLEFZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |