C14H20N2OS — CID 82522939
2-oxo-1-pentyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide (PubChem CID 82522939) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-oxo-1-pentyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide.
| Compound Name | 2-oxo-1-pentyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 82522939 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-oxo-1-pentyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbothioamide |
| SMILES | CCCCCn1c2c(cc(C(N)=S)c1=O)CCC2 |
| InChI | InChI=1S/C14H20N2OS/c1-2-3-4-8-16-12-7-5-6-10(12)9-11(13(15)18)14(16)17/h9H,2-8H2,1H3,(H2,15,18) |
| InChIKey | ONEDTCGDRXOEIY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|