C16H28N2O — CID 82523834
6-tert-butyl-1-propyl-3-(propylaminomethyl)pyridin-2-one (PubChem CID 82523834) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 6-tert-butyl-1-propyl-3-(propylaminomethyl)pyridin-2-one.
| Compound Name | 6-tert-butyl-1-propyl-3-(propylaminomethyl)pyridin-2-one |
|---|---|
| PubChem CID | 82523834 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 6-tert-butyl-1-propyl-3-(propylaminomethyl)pyridin-2-one |
| SMILES | CCCNCc1ccc(C(C)(C)C)n(CCC)c1=O |
| InChI | InChI=1S/C16H28N2O/c1-6-10-17-12-13-8-9-14(16(3,4)5)18(11-7-2)15(13)19/h8-9,17H,6-7,10-12H2,1-5H3 |
| InChIKey | WEQFRDLILRNRDN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|