C18H32N2O — CID 82524193
1-(3-methylbutyl)-3-[(2-methylpropylamino)methyl]-6-propan-2-ylpyridin-2-one (PubChem CID 82524193) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-[(2-methylpropylamino)methyl]-6-propan-2-ylpyridin-2-one.
| Compound Name | 1-(3-methylbutyl)-3-[(2-methylpropylamino)methyl]-6-propan-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 82524193 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 1-(3-methylbutyl)-3-[(2-methylpropylamino)methyl]-6-propan-2-ylpyridin-2-one |
| SMILES | CC(C)CCn1c(C(C)C)ccc(CNCC(C)C)c1=O |
| InChI | InChI=1S/C18H32N2O/c1-13(2)9-10-20-17(15(5)6)8-7-16(18(20)21)12-19-11-14(3)4/h7-8,13-15,19H,9-12H2,1-6H3 |
| InChIKey | WNUOWFUZNAETNZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |