C12H16N4O2S — CID 82525670
1-(2-methoxyethyl)-4,6-dimethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyridin-2-one (PubChem CID 82525670) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4,6-dimethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyridin-2-one.
| Compound Name | 1-(2-methoxyethyl)-4,6-dimethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 82525670 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-(2-methoxyethyl)-4,6-dimethyl-3-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyridin-2-one |
| SMILES | COCCn1c(C)cc(C)c(-c2nc(=S)[nH][nH]2)c1=O |
| InChI | InChI=1S/C12H16N4O2S/c1-7-6-8(2)16(4-5-18-3)11(17)9(7)10-13-12(19)15-14-10/h6H,4-5H2,1-3H3,(H2,13,14,15,19) |
| InChIKey | VKUNRVWLAYUMAV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|