C9H11NO3 — CID 82526321
2-(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)acetic acid (PubChem CID 82526321) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)acetic acid.
| Compound Name | 2-(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)acetic acid |
|---|---|
| PubChem CID | 82526321 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)acetic acid |
| SMILES | Cc1cc(C)c(CC(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H11NO3/c1-5-3-6(2)10-9(13)7(5)4-8(11)12/h3H,4H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | KOHCDWGQNIFECG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |