C13H12Cl2N2O2 — CID 82528185
3-[1-(3,5-dichlorophenyl)-5-methylpyrazol-4-yl]propanoic acid (PubChem CID 82528185) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 3-[1-(3,5-dichlorophenyl)-5-methylpyrazol-4-yl]propanoic acid.
| Compound Name | 3-[1-(3,5-dichlorophenyl)-5-methylpyrazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 82528185 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-[1-(3,5-dichlorophenyl)-5-methylpyrazol-4-yl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)cnn1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-8-9(2-3-13(18)19)7-16-17(8)12-5-10(14)4-11(15)6-12/h4-7H,2-3H2,1H3,(H,18,19) |
| InChIKey | LGESRCVFZBOYKF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |