C17H18ClN3 — CID 82528923
2-(4-butan-2-ylphenyl)-8-chloroimidazo[1,2-a]pyridin-3-amine (PubChem CID 82528923) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)-8-chloroimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(4-butan-2-ylphenyl)-8-chloroimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 82528923 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)-8-chloroimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCC(C)c1ccc(-c2nc3c(Cl)cccn3c2N)cc1 |
| InChI | InChI=1S/C17H18ClN3/c1-3-11(2)12-6-8-13(9-7-12)15-16(19)21-10-4-5-14(18)17(21)20-15/h4-11H,3,19H2,1-2H3 |
| InChIKey | QPSMIGPJVLIFRE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |