C15H14FN3 — CID 82529722
2-(8-fluoro-3-phenylimidazo[1,2-a]pyridin-2-yl)ethanamine (PubChem CID 82529722) has the molecular formula C15H14FN3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-(8-fluoro-3-phenylimidazo[1,2-a]pyridin-2-yl)ethanamine.
| Compound Name | 2-(8-fluoro-3-phenylimidazo[1,2-a]pyridin-2-yl)ethanamine |
|---|---|
| PubChem CID | 82529722 |
| Molecular Formula | C15H14FN3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-(8-fluoro-3-phenylimidazo[1,2-a]pyridin-2-yl)ethanamine |
| SMILES | NCCc1nc2c(F)cccn2c1-c1ccccc1 |
| InChI | InChI=1S/C15H14FN3/c16-12-7-4-10-19-14(11-5-2-1-3-6-11)13(8-9-17)18-15(12)19/h1-7,10H,8-9,17H2 |
| InChIKey | PGCXRHRBKICYDB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |