About 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride
2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride (PubChem CID 82530117) has the molecular formula C7H3Cl3N2O2S
and a molecular weight of 285.54 g/mol. Its IUPAC name is 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride |
| PubChem CID | 82530117 |
| Molecular Formula | C7H3Cl3N2O2S |
| Molecular Weight | 285.54 g/mol |
| Exact Mass | 283.90 |
| IUPAC Name | 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c(Cl)nc2cc(Cl)ccn12 |
| InChI | InChI=1S/C7H3Cl3N2O2S/c8-4-1-2-12-5(3-4)11-6(9)7(12)15(10,13)14/h1-3H |
| InChIKey | YMZKANHOWICQBN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The IUPAC name of 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride (CID 82530117) is 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride.
What is the SMILES notation for 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The canonical SMILES for 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride is O=S(=O)(Cl)c1c(Cl)nc2cc(Cl)ccn12.
What is the InChIKey of 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The InChIKey is YMZKANHOWICQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl3N2O2S/c8-4-1-2-12-5(3-4)11-6(9)7(12)15(10,13)14/h1-3H.
What are the key properties of 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride has a molecular weight of 285.54 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dichloroimidazo[1,2-a]pyridine-3-sulfonyl chloride is sourced from PubChem (CID 82530117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).